C21H22N8O7 — CID 135949625
7-[(2R)-3-(3-ethylphenoxy)-2-hydroxypropyl]-8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3-methylpurine-2,6-dione (PubChem CID 135949625) has the molecular formula C21H22N8O7 and a molecular weight of 498.46 g/mol. Its IUPAC name is 7-[(2R)-3-(3-ethylphenoxy)-2-hydroxypropyl]-8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3-methylpurine-2,6-dione.
| Compound Name | 7-[(2R)-3-(3-ethylphenoxy)-2-hydroxypropyl]-8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 135949625 |
| Molecular Formula | C21H22N8O7 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 7-[(2R)-3-(3-ethylphenoxy)-2-hydroxypropyl]-8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-3-methylpurine-2,6-dione |
| SMILES | CCc1cccc(OC[C@H](O)Cn2c(/N=N/c3c(O)[nH]c(=O)[nH]c3=O)nc3c2c(=O)[nH]c(=O)n3C)c1 |
| InChI | InChI=1S/C21H22N8O7/c1-3-10-5-4-6-12(7-10)36-9-11(30)8-29-14-15(28(2)21(35)25-18(14)33)22-19(29)27-26-13-16(31)23-20(34)24-17(13)32/h4-7,11,30H,3,8-9H2,1-2H3,(H,25,33,35)(H3,23,24,31,32,34)/b27-26+/t11-/m1/s1 |
| InChIKey | WUYYJIVTVHRYGH-WRPYEXKDSA-N |
| XLogP | -0.08 |
| TPSA | 212.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|