C20H20N8O7 — CID 136800879
8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]-3-methylpurine-2,6-dione (PubChem CID 136800879) has the molecular formula C20H20N8O7 and a molecular weight of 484.43 g/mol. Its IUPAC name is 8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 136800879 |
| Molecular Formula | C20H20N8O7 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 8-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(3-methylphenoxy)propyl]-3-methylpurine-2,6-dione |
| SMILES | Cc1cccc(OC[C@H](O)Cn2c(/N=N/c3c(O)[nH]c(=O)[nH]c3=O)nc3c2c(=O)[nH]c(=O)n3C)c1 |
| InChI | InChI=1S/C20H20N8O7/c1-9-4-3-5-11(6-9)35-8-10(29)7-28-13-14(27(2)20(34)24-17(13)32)21-18(28)26-25-12-15(30)22-19(33)23-16(12)31/h3-6,10,29H,7-8H2,1-2H3,(H,24,32,34)(H3,22,23,30,31,33)/b26-25+/t10-/m1/s1 |
| InChIKey | INQJUOSBJLROSA-YBWPCYQRSA-N |
| XLogP | -0.33 |
| TPSA | 212.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|