C27H23N7O5 — CID 3735631
8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-(2-hydroxy-3-naphthalen-2-yloxypropyl)-3-methylpurine-2,6-dione (PubChem CID 3735631) has the molecular formula C27H23N7O5 and a molecular weight of 525.53 g/mol. Its IUPAC name is 8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-(2-hydroxy-3-naphthalen-2-yloxypropyl)-3-methylpurine-2,6-dione.
| Compound Name | 8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-(2-hydroxy-3-naphthalen-2-yloxypropyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3735631 |
| Molecular Formula | C27H23N7O5 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-(2-hydroxy-3-naphthalen-2-yloxypropyl)-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(/N=N/c1c(O)[nH]c3ccccc13)n2CC(O)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H23N7O5/c1-33-23-22(25(37)30-27(33)38)34(13-17(35)14-39-18-11-10-15-6-2-3-7-16(15)12-18)26(29-23)32-31-21-19-8-4-5-9-20(19)28-24(21)36/h2-12,17,28,35-36H,13-14H2,1H3,(H,30,37,38)/b32-31+ |
| InChIKey | XEDJYGIJKPCNQI-QNEJGDQOSA-N |
| XLogP | 3.62 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|