C25H25N7O5 — CID 136915561
8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 136915561) has the molecular formula C25H25N7O5 and a molecular weight of 503.52 g/mol. Its IUPAC name is 8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 136915561 |
| Molecular Formula | C25H25N7O5 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 8-[(2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cc1ccccc1OC[C@H](O)Cn1c(/N=N/c2c(O)[nH]c3ccccc23)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C25H25N7O5/c1-14-8-4-7-11-18(14)37-13-15(33)12-32-20-21(30(2)25(36)31(3)23(20)35)27-24(32)29-28-19-16-9-5-6-10-17(16)26-22(19)34/h4-11,15,26,33-34H,12-13H2,1-3H3/b29-28+/t15-/m1/s1 |
| InChIKey | VQNDRPUUCHZKBA-FSGUPOOJSA-N |
| XLogP | 2.78 |
| TPSA | 152.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|