C22H22ClN5O4 — CID 1103217
8-(benzylamino)-7-[(2R)-3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione (PubChem CID 1103217) has the molecular formula C22H22ClN5O4 and a molecular weight of 455.90 g/mol. Its IUPAC name is 8-(benzylamino)-7-[(2R)-3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-(benzylamino)-7-[(2R)-3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 1103217 |
| Molecular Formula | C22H22ClN5O4 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 8-(benzylamino)-7-[(2R)-3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(NCc1ccccc1)n2C[C@@H](O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClN5O4/c1-27-19-18(20(30)26-22(27)31)28(21(25-19)24-11-14-5-3-2-4-6-14)12-16(29)13-32-17-9-7-15(23)8-10-17/h2-10,16,29H,11-13H2,1H3,(H,24,25)(H,26,30,31)/t16-/m1/s1 |
| InChIKey | KTLDBBWPUCTAFE-MRXNPFEDSA-N |
| XLogP | 2.13 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |