C22H23N5O4 — CID 3107945
8-(benzylamino)-7-(2-hydroxy-3-phenoxypropyl)-3-methylpurine-2,6-dione (PubChem CID 3107945) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is 8-(benzylamino)-7-(2-hydroxy-3-phenoxypropyl)-3-methylpurine-2,6-dione.
| Compound Name | 8-(benzylamino)-7-(2-hydroxy-3-phenoxypropyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3107945 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 8-(benzylamino)-7-(2-hydroxy-3-phenoxypropyl)-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(NCc1ccccc1)n2CC(O)COc1ccccc1 |
| InChI | InChI=1S/C22H23N5O4/c1-26-19-18(20(29)25-22(26)30)27(13-16(28)14-31-17-10-6-3-7-11-17)21(24-19)23-12-15-8-4-2-5-9-15/h2-11,16,28H,12-14H2,1H3,(H,23,24)(H,25,29,30) |
| InChIKey | WQBDCGSPWQNPHX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |