C22H22Cl2N6O5 — CID 171151048
7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-8-[2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-methylpurine-2,6-dione;hydrochloride (PubChem CID 171151048) has the molecular formula C22H22Cl2N6O5 and a molecular weight of 521.36 g/mol. Its IUPAC name is 7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-8-[2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-methylpurine-2,6-dione;hydrochloride.
| Compound Name | 7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-8-[2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-methylpurine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 171151048 |
| Molecular Formula | C22H22Cl2N6O5 |
| Molecular Weight | 521.36 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | 7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-8-[2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-methylpurine-2,6-dione;hydrochloride |
| SMILES | Cl.Cn1c(=O)[nH]c(=O)c2c1nc(NN=Cc1ccccc1O)n2CC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClN6O5.ClH/c1-28-19-18(20(32)26-22(28)33)29(11-15(30)12-34-16-8-6-14(23)7-9-16)21(25-19)27-24-10-13-4-2-3-5-17(13)31;/h2-10,15,30-31H,11-12H2,1H3,(H,25,27)(H,26,32,33);1H |
| InChIKey | CIALQYVZISTZRM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 146.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|