C23H23BrN6O6 — CID 137066001
8-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-7-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]-3-methylpurine-2,6-dione (PubChem CID 137066001) has the molecular formula C23H23BrN6O6 and a molecular weight of 559.38 g/mol. Its IUPAC name is 8-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-7-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-7-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 137066001 |
| Molecular Formula | C23H23BrN6O6 |
| Molecular Weight | 559.38 g/mol |
| Exact Mass | 558.09 |
| IUPAC Name | 8-[(2E)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-7-[(2S)-2-hydroxy-3-(4-methoxyphenoxy)propyl]-3-methylpurine-2,6-dione |
| SMILES | COc1ccc(OC[C@@H](O)Cn2c(N/N=C/c3cc(Br)ccc3O)nc3c2c(=O)[nH]c(=O)n3C)cc1 |
| InChI | InChI=1S/C23H23BrN6O6/c1-29-20-19(21(33)27-23(29)34)30(11-15(31)12-36-17-6-4-16(35-2)5-7-17)22(26-20)28-25-10-13-9-14(24)3-8-18(13)32/h3-10,15,31-32H,11-12H2,1-2H3,(H,26,28)(H,27,33,34)/b25-10+/t15-/m0/s1 |
| InChIKey | RSJOHQHDYYAQTI-IDDUFPAYSA-N |
| XLogP | 1.79 |
| TPSA | 155.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.38 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|