C23H23BrN6O5 — CID 136889991
8-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-7-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]-3-methylpurine-2,6-dione (PubChem CID 136889991) has the molecular formula C23H23BrN6O5 and a molecular weight of 543.38 g/mol. Its IUPAC name is 8-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-7-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-7-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 136889991 |
| Molecular Formula | C23H23BrN6O5 |
| Molecular Weight | 543.38 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | 8-[(2Z)-2-[(5-bromo-2-hydroxyphenyl)methylidene]hydrazinyl]-7-[(2S)-2-hydroxy-3-(2-methylphenoxy)propyl]-3-methylpurine-2,6-dione |
| SMILES | Cc1ccccc1OC[C@@H](O)Cn1c(N/N=C\c2cc(Br)ccc2O)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C23H23BrN6O5/c1-13-5-3-4-6-18(13)35-12-16(31)11-30-19-20(29(2)23(34)27-21(19)33)26-22(30)28-25-10-14-9-15(24)7-8-17(14)32/h3-10,16,31-32H,11-12H2,1-2H3,(H,26,28)(H,27,33,34)/b25-10-/t16-/m0/s1 |
| InChIKey | JRWRECWZEKPCDD-WVQWDSLKSA-N |
| XLogP | 2.09 |
| TPSA | 146.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|