C16H20N6O4 — CID 7007070
8-hydrazinyl-7-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]-3-methylpurine-2,6-dione (PubChem CID 7007070) has the molecular formula C16H20N6O4 and a molecular weight of 360.37 g/mol. Its IUPAC name is 8-hydrazinyl-7-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-hydrazinyl-7-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 7007070 |
| Molecular Formula | C16H20N6O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 8-hydrazinyl-7-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]-3-methylpurine-2,6-dione |
| SMILES | Cc1ccccc1OC[C@H](O)Cn1c(NN)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C16H20N6O4/c1-9-5-3-4-6-11(9)26-8-10(23)7-22-12-13(18-15(22)20-17)21(2)16(25)19-14(12)24/h3-6,10,23H,7-8,17H2,1-2H3,(H,18,20)(H,19,24,25)/t10-/m1/s1 |
| InChIKey | IULCFNDAJHAVBR-SNVBAGLBSA-N |
| XLogP | -0.54 |
| TPSA | 140.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|