C23H24N6O4 — CID 40893474
8-[(2Z)-2-benzylidenehydrazinyl]-7-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]-3-methylpurine-2,6-dione (PubChem CID 40893474) has the molecular formula C23H24N6O4 and a molecular weight of 448.48 g/mol. Its IUPAC name is 8-[(2Z)-2-benzylidenehydrazinyl]-7-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-[(2Z)-2-benzylidenehydrazinyl]-7-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 40893474 |
| Molecular Formula | C23H24N6O4 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 8-[(2Z)-2-benzylidenehydrazinyl]-7-[(2R)-2-hydroxy-3-(2-methylphenoxy)propyl]-3-methylpurine-2,6-dione |
| SMILES | Cc1ccccc1OC[C@H](O)Cn1c(N/N=C\c2ccccc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C23H24N6O4/c1-15-8-6-7-11-18(15)33-14-17(30)13-29-19-20(28(2)23(32)26-21(19)31)25-22(29)27-24-12-16-9-4-3-5-10-16/h3-12,17,30H,13-14H2,1-2H3,(H,25,27)(H,26,31,32)/b24-12-/t17-/m1/s1 |
| InChIKey | FHZXHBLJVVWHKE-SAMUYDCASA-N |
| XLogP | 1.62 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|