C22H23N7O4 — CID 40937660
7-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione (PubChem CID 40937660) has the molecular formula C22H23N7O4 and a molecular weight of 449.47 g/mol. Its IUPAC name is 7-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione.
| Compound Name | 7-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 40937660 |
| Molecular Formula | C22H23N7O4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 7-[(2S)-2-hydroxy-3-(4-methylphenoxy)propyl]-3-methyl-8-[(2Z)-2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione |
| SMILES | Cc1ccc(OC[C@@H](O)Cn2c(N/N=C\c3cccnc3)nc3c2c(=O)[nH]c(=O)n3C)cc1 |
| InChI | InChI=1S/C22H23N7O4/c1-14-5-7-17(8-6-14)33-13-16(30)12-29-18-19(28(2)22(32)26-20(18)31)25-21(29)27-24-11-15-4-3-9-23-10-15/h3-11,16,30H,12-13H2,1-2H3,(H,25,27)(H,26,31,32)/b24-11-/t16-/m0/s1 |
| InChIKey | VEIIRHXVHNFLHI-PDHRUYIUSA-N |
| XLogP | 1.01 |
| TPSA | 139.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|