C23H24N6O6 — CID 135822110
8-[(2E)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-7-[2-hydroxy-3-(4-methylphenoxy)propyl]-3-methylpurine-2,6-dione (PubChem CID 135822110) has the molecular formula C23H24N6O6 and a molecular weight of 480.48 g/mol. Its IUPAC name is 8-[(2E)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-7-[2-hydroxy-3-(4-methylphenoxy)propyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-[(2E)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-7-[2-hydroxy-3-(4-methylphenoxy)propyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 135822110 |
| Molecular Formula | C23H24N6O6 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 8-[(2E)-2-[(2,4-dihydroxyphenyl)methylidene]hydrazinyl]-7-[2-hydroxy-3-(4-methylphenoxy)propyl]-3-methylpurine-2,6-dione |
| SMILES | Cc1ccc(OCC(O)Cn2c(N/N=C/c3ccc(O)cc3O)nc3c2c(=O)[nH]c(=O)n3C)cc1 |
| InChI | InChI=1S/C23H24N6O6/c1-13-3-7-17(8-4-13)35-12-16(31)11-29-19-20(28(2)23(34)26-21(19)33)25-22(29)27-24-10-14-5-6-15(30)9-18(14)32/h3-10,16,30-32H,11-12H2,1-2H3,(H,25,27)(H,26,33,34)/b24-10+ |
| InChIKey | LBPSZBIAUDDMKV-YSURURNPSA-N |
| XLogP | 1.03 |
| TPSA | 166.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|