C19H24N6O5 — CID 136747867
8-[(2Z)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-7-[(2S)-2-hydroxy-3-propan-2-yloxypropyl]-3-methylpurine-2,6-dione (PubChem CID 136747867) has the molecular formula C19H24N6O5 and a molecular weight of 416.44 g/mol. Its IUPAC name is 8-[(2Z)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-7-[(2S)-2-hydroxy-3-propan-2-yloxypropyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-[(2Z)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-7-[(2S)-2-hydroxy-3-propan-2-yloxypropyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 136747867 |
| Molecular Formula | C19H24N6O5 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 8-[(2Z)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-7-[(2S)-2-hydroxy-3-propan-2-yloxypropyl]-3-methylpurine-2,6-dione |
| SMILES | CC(C)OC[C@@H](O)Cn1c(N/N=C\c2ccccc2O)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C19H24N6O5/c1-11(2)30-10-13(26)9-25-15-16(24(3)19(29)22-17(15)28)21-18(25)23-20-8-12-6-4-5-7-14(12)27/h4-8,11,13,26-27H,9-10H2,1-3H3,(H,21,23)(H,22,28,29)/b20-8-/t13-/m0/s1 |
| InChIKey | WXVSBZKPEWFEPC-QFUZRPNGSA-N |
| XLogP | 0.36 |
| TPSA | 146.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|