C19H23N7O6 — CID 93007767
7-[(2S)-2-hydroxy-3-propan-2-yloxypropyl]-3-methyl-8-[(2E)-2-[(4-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione (PubChem CID 93007767) has the molecular formula C19H23N7O6 and a molecular weight of 445.44 g/mol. Its IUPAC name is 7-[(2S)-2-hydroxy-3-propan-2-yloxypropyl]-3-methyl-8-[(2E)-2-[(4-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione.
| Compound Name | 7-[(2S)-2-hydroxy-3-propan-2-yloxypropyl]-3-methyl-8-[(2E)-2-[(4-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 93007767 |
| Molecular Formula | C19H23N7O6 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 7-[(2S)-2-hydroxy-3-propan-2-yloxypropyl]-3-methyl-8-[(2E)-2-[(4-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione |
| SMILES | CC(C)OC[C@@H](O)Cn1c(N/N=C/c2ccc([N+](=O)[O-])cc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C19H23N7O6/c1-11(2)32-10-14(27)9-25-15-16(24(3)19(29)22-17(15)28)21-18(25)23-20-8-12-4-6-13(7-5-12)26(30)31/h4-8,11,14,27H,9-10H2,1-3H3,(H,21,23)(H,22,28,29)/b20-8+/t14-/m0/s1 |
| InChIKey | QFPRQSDFIHEVAX-CSLHCHJMSA-N |
| XLogP | 0.56 |
| TPSA | 169.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|