C19H24N6O3 — CID 4219093
8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-(2-methylpropyl)purine-2,6-dione (PubChem CID 4219093) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-(2-methylpropyl)purine-2,6-dione.
| Compound Name | 8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-(2-methylpropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 4219093 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 8-[2-[(4-ethoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-(2-methylpropyl)purine-2,6-dione |
| SMILES | CCOc1ccc(C=NNc2nc3c(c(=O)[nH]c(=O)n3C)n2CC(C)C)cc1 |
| InChI | InChI=1S/C19H24N6O3/c1-5-28-14-8-6-13(7-9-14)10-20-23-18-21-16-15(25(18)11-12(2)3)17(26)22-19(27)24(16)4/h6-10,12H,5,11H2,1-4H3,(H,21,23)(H,22,26,27) |
| InChIKey | CBBAICHRAYVCNV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|