C18H22N6O4 — CID 135717268
8-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-(2-methylpropyl)purine-2,6-dione (PubChem CID 135717268) has the molecular formula C18H22N6O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is 8-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-(2-methylpropyl)purine-2,6-dione.
| Compound Name | 8-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-(2-methylpropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 135717268 |
| Molecular Formula | C18H22N6O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 8-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-(2-methylpropyl)purine-2,6-dione |
| SMILES | COc1cccc(/C=N/Nc2nc3c(c(=O)[nH]c(=O)n3C)n2CC(C)C)c1O |
| InChI | InChI=1S/C18H22N6O4/c1-10(2)9-24-13-15(23(3)18(27)21-16(13)26)20-17(24)22-19-8-11-6-5-7-12(28-4)14(11)25/h5-8,10,25H,9H2,1-4H3,(H,20,22)(H,21,26,27)/b19-8+ |
| InChIKey | WIPXSRULDLFKGT-UFWORHAWSA-N |
| XLogP | 1.24 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|