C17H18ClFN6O2 — CID 6027536
8-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-3-methyl-7-(2-methylpropyl)purine-2,6-dione (PubChem CID 6027536) has the molecular formula C17H18ClFN6O2 and a molecular weight of 392.82 g/mol. Its IUPAC name is 8-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-3-methyl-7-(2-methylpropyl)purine-2,6-dione.
| Compound Name | 8-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-3-methyl-7-(2-methylpropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 6027536 |
| Molecular Formula | C17H18ClFN6O2 |
| Molecular Weight | 392.82 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 8-[(2Z)-2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-3-methyl-7-(2-methylpropyl)purine-2,6-dione |
| SMILES | CC(C)Cn1c(N/N=C\c2c(F)cccc2Cl)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C17H18ClFN6O2/c1-9(2)8-25-13-14(24(3)17(27)22-15(13)26)21-16(25)23-20-7-10-11(18)5-4-6-12(10)19/h4-7,9H,8H2,1-3H3,(H,21,23)(H,22,26,27)/b20-7- |
| InChIKey | SROJIUKJSXVQTH-SCDVKCJHSA-N |
| XLogP | 2.32 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.82 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|