C20H15ClF2N6O2 — CID 4552354
8-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione (PubChem CID 4552354) has the molecular formula C20H15ClF2N6O2 and a molecular weight of 444.83 g/mol. Its IUPAC name is 8-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 4552354 |
| Molecular Formula | C20H15ClF2N6O2 |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 8-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-7-[(4-fluorophenyl)methyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(NN=Cc1c(F)cccc1Cl)n2Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H15ClF2N6O2/c1-28-17-16(18(30)26-20(28)31)29(10-11-5-7-12(22)8-6-11)19(25-17)27-24-9-13-14(21)3-2-4-15(13)23/h2-9H,10H2,1H3,(H,25,27)(H,26,30,31) |
| InChIKey | UOJJZDZSHBNBIK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|