C21H19ClN6O2 — CID 44967615
8-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-3-methyl-7-[(3-methylphenyl)methyl]purine-2,6-dione (PubChem CID 44967615) has the molecular formula C21H19ClN6O2 and a molecular weight of 422.88 g/mol. Its IUPAC name is 8-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-3-methyl-7-[(3-methylphenyl)methyl]purine-2,6-dione.
| Compound Name | 8-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-3-methyl-7-[(3-methylphenyl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 44967615 |
| Molecular Formula | C21H19ClN6O2 |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 8-[(2E)-2-[(4-chlorophenyl)methylidene]hydrazinyl]-3-methyl-7-[(3-methylphenyl)methyl]purine-2,6-dione |
| SMILES | Cc1cccc(Cn2c(N/N=C/c3ccc(Cl)cc3)nc3c2c(=O)[nH]c(=O)n3C)c1 |
| InChI | InChI=1S/C21H19ClN6O2/c1-13-4-3-5-15(10-13)12-28-17-18(27(2)21(30)25-19(17)29)24-20(28)26-23-11-14-6-8-16(22)9-7-14/h3-11H,12H2,1-2H3,(H,24,26)(H,25,29,30)/b23-11+ |
| InChIKey | AEDUHAZEKBXODP-FOKLQQMPSA-N |
| XLogP | 2.88 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|