C15H16N6O2 — CID 5149414
8-(2-benzylidenehydrazinyl)-7-ethyl-3-methylpurine-2,6-dione (PubChem CID 5149414) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is 8-(2-benzylidenehydrazinyl)-7-ethyl-3-methylpurine-2,6-dione.
| Compound Name | 8-(2-benzylidenehydrazinyl)-7-ethyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 5149414 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 8-(2-benzylidenehydrazinyl)-7-ethyl-3-methylpurine-2,6-dione |
| SMILES | CCn1c(NN=Cc2ccccc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C15H16N6O2/c1-3-21-11-12(20(2)15(23)18-13(11)22)17-14(21)19-16-9-10-7-5-4-6-8-10/h4-9H,3H2,1-2H3,(H,17,19)(H,18,22,23) |
| InChIKey | IQCHTNKDENNBPW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|