C17H17ClN6O2 — CID 3104108
8-(2-benzylidenehydrazinyl)-7-(3-chlorobut-2-enyl)-3-methylpurine-2,6-dione (PubChem CID 3104108) has the molecular formula C17H17ClN6O2 and a molecular weight of 372.82 g/mol. Its IUPAC name is 8-(2-benzylidenehydrazinyl)-7-(3-chlorobut-2-enyl)-3-methylpurine-2,6-dione.
| Compound Name | 8-(2-benzylidenehydrazinyl)-7-(3-chlorobut-2-enyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 3104108 |
| Molecular Formula | C17H17ClN6O2 |
| Molecular Weight | 372.82 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 8-(2-benzylidenehydrazinyl)-7-(3-chlorobut-2-enyl)-3-methylpurine-2,6-dione |
| SMILES | CC(Cl)=CCn1c(NN=Cc2ccccc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C17H17ClN6O2/c1-11(18)8-9-24-13-14(23(2)17(26)21-15(13)25)20-16(24)22-19-10-12-6-4-3-5-7-12/h3-8,10H,9H2,1-2H3,(H,20,22)(H,21,25,26) |
| InChIKey | INMHIGYFTYWHNP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.82 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|