C18H22N6O2 — CID 3097628
8-(2-benzylidenehydrazinyl)-3-methyl-7-pentylpurine-2,6-dione (PubChem CID 3097628) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 8-(2-benzylidenehydrazinyl)-3-methyl-7-pentylpurine-2,6-dione.
| Compound Name | 8-(2-benzylidenehydrazinyl)-3-methyl-7-pentylpurine-2,6-dione |
|---|---|
| PubChem CID | 3097628 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 8-(2-benzylidenehydrazinyl)-3-methyl-7-pentylpurine-2,6-dione |
| SMILES | CCCCCn1c(NN=Cc2ccccc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C18H22N6O2/c1-3-4-8-11-24-14-15(23(2)18(26)21-16(14)25)20-17(24)22-19-12-13-9-6-5-7-10-13/h5-7,9-10,12H,3-4,8,11H2,1-2H3,(H,20,22)(H,21,25,26) |
| InChIKey | VDWHFKNAJNOFSP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|