C21H28N6O3 — CID 171138038
8-[2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-methyl-7-octylpurine-2,6-dione (PubChem CID 171138038) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is 8-[2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-methyl-7-octylpurine-2,6-dione.
| Compound Name | 8-[2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-methyl-7-octylpurine-2,6-dione |
|---|---|
| PubChem CID | 171138038 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 8-[2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-3-methyl-7-octylpurine-2,6-dione |
| SMILES | CCCCCCCCn1c(NN=Cc2ccccc2O)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C21H28N6O3/c1-3-4-5-6-7-10-13-27-17-18(26(2)21(30)24-19(17)29)23-20(27)25-22-14-15-11-8-9-12-16(15)28/h8-9,11-12,14,28H,3-7,10,13H2,1-2H3,(H,23,25)(H,24,29,30) |
| InChIKey | AGNNAMZMWAOZJK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|