C17H20N6O2 — CID 3792261
3-methyl-8-[2-[(4-methylphenyl)methylidene]hydrazinyl]-7-propylpurine-2,6-dione (PubChem CID 3792261) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is 3-methyl-8-[2-[(4-methylphenyl)methylidene]hydrazinyl]-7-propylpurine-2,6-dione.
| Compound Name | 3-methyl-8-[2-[(4-methylphenyl)methylidene]hydrazinyl]-7-propylpurine-2,6-dione |
|---|---|
| PubChem CID | 3792261 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-methyl-8-[2-[(4-methylphenyl)methylidene]hydrazinyl]-7-propylpurine-2,6-dione |
| SMILES | CCCn1c(NN=Cc2ccc(C)cc2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C17H20N6O2/c1-4-9-23-13-14(22(3)17(25)20-15(13)24)19-16(23)21-18-10-12-7-5-11(2)6-8-12/h5-8,10H,4,9H2,1-3H3,(H,19,21)(H,20,24,25) |
| InChIKey | FMDPGEHYMKMGFP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|