C23H31N7O4 — CID 98130185
7-decyl-3-methyl-8-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione (PubChem CID 98130185) has the molecular formula C23H31N7O4 and a molecular weight of 469.55 g/mol. Its IUPAC name is 7-decyl-3-methyl-8-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione.
| Compound Name | 7-decyl-3-methyl-8-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 98130185 |
| Molecular Formula | C23H31N7O4 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 7-decyl-3-methyl-8-[(2E)-2-[(3-nitrophenyl)methylidene]hydrazinyl]purine-2,6-dione |
| SMILES | CCCCCCCCCCn1c(N/N=C/c2cccc([N+](=O)[O-])c2)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C23H31N7O4/c1-3-4-5-6-7-8-9-10-14-29-19-20(28(2)23(32)26-21(19)31)25-22(29)27-24-16-17-12-11-13-18(15-17)30(33)34/h11-13,15-16H,3-10,14H2,1-2H3,(H,25,27)(H,26,31,32)/b24-16+ |
| InChIKey | OCOCPQCHQNMROJ-LFVJCYFKSA-N |
| XLogP | 3.92 |
| TPSA | 140.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|