C23H24N6O4 — CID 91901277
8-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-(3-phenoxypropyl)purine-2,6-dione (PubChem CID 91901277) has the molecular formula C23H24N6O4 and a molecular weight of 448.48 g/mol. Its IUPAC name is 8-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-(3-phenoxypropyl)purine-2,6-dione.
| Compound Name | 8-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-(3-phenoxypropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 91901277 |
| Molecular Formula | C23H24N6O4 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 8-[(2E)-2-[(3-methoxyphenyl)methylidene]hydrazinyl]-3-methyl-7-(3-phenoxypropyl)purine-2,6-dione |
| SMILES | COc1cccc(/C=N/Nc2nc3c(c(=O)[nH]c(=O)n3C)n2CCCOc2ccccc2)c1 |
| InChI | InChI=1S/C23H24N6O4/c1-28-20-19(21(30)26-23(28)31)29(12-7-13-33-17-9-4-3-5-10-17)22(25-20)27-24-15-16-8-6-11-18(14-16)32-2/h3-6,8-11,14-15H,7,12-13H2,1-2H3,(H,25,27)(H,26,30,31)/b24-15+ |
| InChIKey | MUILLYYFLFGREZ-BUVRLJJBSA-N |
| XLogP | 2.35 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|