C19H23ClN6O4 — CID 6154628
8-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-7-(2-hydroxy-3-propan-2-yloxypropyl)-3-methylpurine-2,6-dione (PubChem CID 6154628) has the molecular formula C19H23ClN6O4 and a molecular weight of 434.88 g/mol. Its IUPAC name is 8-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-7-(2-hydroxy-3-propan-2-yloxypropyl)-3-methylpurine-2,6-dione.
| Compound Name | 8-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-7-(2-hydroxy-3-propan-2-yloxypropyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 6154628 |
| Molecular Formula | C19H23ClN6O4 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 8-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-7-(2-hydroxy-3-propan-2-yloxypropyl)-3-methylpurine-2,6-dione |
| SMILES | CC(C)OCC(O)Cn1c(N/N=C\c2ccccc2Cl)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C19H23ClN6O4/c1-11(2)30-10-13(27)9-26-15-16(25(3)19(29)23-17(15)28)22-18(26)24-21-8-12-6-4-5-7-14(12)20/h4-8,11,13,27H,9-10H2,1-3H3,(H,22,24)(H,23,28,29)/b21-8- |
| InChIKey | BRMQCGTXBOEJLM-WNFQYIGGSA-N |
| XLogP | 1.31 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|