C14H13ClN6O2 — CID 4003251
8-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 4003251) has the molecular formula C14H13ClN6O2 and a molecular weight of 332.75 g/mol. Its IUPAC name is 8-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 4003251 |
| Molecular Formula | C14H13ClN6O2 |
| Molecular Weight | 332.75 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 8-[2-[(2-chlorophenyl)methylidene]hydrazinyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(NN=Cc2ccccc2Cl)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C14H13ClN6O2/c1-20-10-11(21(2)14(23)18-12(10)22)17-13(20)19-16-7-8-5-3-4-6-9(8)15/h3-7H,1-2H3,(H,17,19)(H,18,22,23) |
| InChIKey | NVDOLCHOPHTUTR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.75 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|