C16H17FN6O4 — CID 7367860
7-[(2S)-2,3-dihydroxypropyl]-8-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]-3-methylpurine-2,6-dione (PubChem CID 7367860) has the molecular formula C16H17FN6O4 and a molecular weight of 376.35 g/mol. Its IUPAC name is 7-[(2S)-2,3-dihydroxypropyl]-8-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]-3-methylpurine-2,6-dione.
| Compound Name | 7-[(2S)-2,3-dihydroxypropyl]-8-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 7367860 |
| Molecular Formula | C16H17FN6O4 |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 7-[(2S)-2,3-dihydroxypropyl]-8-[(2Z)-2-[(4-fluorophenyl)methylidene]hydrazinyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N/N=C\c1ccc(F)cc1)n2C[C@H](O)CO |
| InChI | InChI=1S/C16H17FN6O4/c1-22-13-12(14(26)20-16(22)27)23(7-11(25)8-24)15(19-13)21-18-6-9-2-4-10(17)5-3-9/h2-6,11,24-25H,7-8H2,1H3,(H,19,21)(H,20,26,27)/b18-6-/t11-/m0/s1 |
| InChIKey | UXXZPZMYBIGQEB-XKRMMWHISA-N |
| XLogP | -0.64 |
| TPSA | 137.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|