C21H21N7O4 — CID 40964880
7-[(2R)-2-hydroxy-3-phenoxypropyl]-3-methyl-8-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]purine-2,6-dione (PubChem CID 40964880) has the molecular formula C21H21N7O4 and a molecular weight of 435.44 g/mol. Its IUPAC name is 7-[(2R)-2-hydroxy-3-phenoxypropyl]-3-methyl-8-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]purine-2,6-dione.
| Compound Name | 7-[(2R)-2-hydroxy-3-phenoxypropyl]-3-methyl-8-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 40964880 |
| Molecular Formula | C21H21N7O4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 7-[(2R)-2-hydroxy-3-phenoxypropyl]-3-methyl-8-[(2Z)-2-(pyridin-4-ylmethylidene)hydrazinyl]purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N/N=C\c1ccncc1)n2C[C@@H](O)COc1ccccc1 |
| InChI | InChI=1S/C21H21N7O4/c1-27-18-17(19(30)25-21(27)31)28(12-15(29)13-32-16-5-3-2-4-6-16)20(24-18)26-23-11-14-7-9-22-10-8-14/h2-11,15,29H,12-13H2,1H3,(H,24,26)(H,25,30,31)/b23-11-/t15-/m1/s1 |
| InChIKey | QMXYJBFAMZGUCZ-FCBDRWCKSA-N |
| XLogP | 0.70 |
| TPSA | 139.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|