C20H19N7O3 — CID 3565475
7-(2-hydroxy-2-phenylethyl)-3-methyl-8-[2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione (PubChem CID 3565475) has the molecular formula C20H19N7O3 and a molecular weight of 405.42 g/mol. Its IUPAC name is 7-(2-hydroxy-2-phenylethyl)-3-methyl-8-[2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione.
| Compound Name | 7-(2-hydroxy-2-phenylethyl)-3-methyl-8-[2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 3565475 |
| Molecular Formula | C20H19N7O3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 7-(2-hydroxy-2-phenylethyl)-3-methyl-8-[2-(pyridin-3-ylmethylidene)hydrazinyl]purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(NN=Cc1cccnc1)n2CC(O)c1ccccc1 |
| InChI | InChI=1S/C20H19N7O3/c1-26-17-16(18(29)24-20(26)30)27(12-15(28)14-7-3-2-4-8-14)19(23-17)25-22-11-13-6-5-9-21-10-13/h2-11,15,28H,12H2,1H3,(H,23,25)(H,24,29,30) |
| InChIKey | ULWGMJCCHRQVAQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 130.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|