C23H23BrN6O4 — CID 3848158
7-[3-(4-bromophenoxy)-2-hydroxypropyl]-3-methyl-8-[2-(1-phenylethylidene)hydrazinyl]purine-2,6-dione (PubChem CID 3848158) has the molecular formula C23H23BrN6O4 and a molecular weight of 527.38 g/mol. Its IUPAC name is 7-[3-(4-bromophenoxy)-2-hydroxypropyl]-3-methyl-8-[2-(1-phenylethylidene)hydrazinyl]purine-2,6-dione.
| Compound Name | 7-[3-(4-bromophenoxy)-2-hydroxypropyl]-3-methyl-8-[2-(1-phenylethylidene)hydrazinyl]purine-2,6-dione |
|---|---|
| PubChem CID | 3848158 |
| Molecular Formula | C23H23BrN6O4 |
| Molecular Weight | 527.38 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 7-[3-(4-bromophenoxy)-2-hydroxypropyl]-3-methyl-8-[2-(1-phenylethylidene)hydrazinyl]purine-2,6-dione |
| SMILES | CC(=NNc1nc2c(c(=O)[nH]c(=O)n2C)n1CC(O)COc1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H23BrN6O4/c1-14(15-6-4-3-5-7-15)27-28-22-25-20-19(21(32)26-23(33)29(20)2)30(22)12-17(31)13-34-18-10-8-16(24)9-11-18/h3-11,17,31H,12-13H2,1-2H3,(H,25,28)(H,26,32,33) |
| InChIKey | KDKHLBQZEXOAFM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 126.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|