C23H20ClN5O7S — CID 92904925
7-[(2S)-3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methyl-8-[2-(4-nitrophenyl)-2-oxoethyl]sulfanylpurine-2,6-dione (PubChem CID 92904925) has the molecular formula C23H20ClN5O7S and a molecular weight of 545.96 g/mol. Its IUPAC name is 7-[(2S)-3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methyl-8-[2-(4-nitrophenyl)-2-oxoethyl]sulfanylpurine-2,6-dione.
| Compound Name | 7-[(2S)-3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methyl-8-[2-(4-nitrophenyl)-2-oxoethyl]sulfanylpurine-2,6-dione |
|---|---|
| PubChem CID | 92904925 |
| Molecular Formula | C23H20ClN5O7S |
| Molecular Weight | 545.96 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | 7-[(2S)-3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methyl-8-[2-(4-nitrophenyl)-2-oxoethyl]sulfanylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(SCC(=O)c1ccc([N+](=O)[O-])cc1)n2C[C@H](O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClN5O7S/c1-27-20-19(21(32)26-22(27)33)28(10-16(30)11-36-17-8-4-14(24)5-9-17)23(25-20)37-12-18(31)13-2-6-15(7-3-13)29(34)35/h2-9,16,30H,10-12H2,1H3,(H,26,32,33)/t16-/m0/s1 |
| InChIKey | ZKZXBXIMGAXYHP-INIZCTEOSA-N |
| XLogP | 2.40 |
| TPSA | 162.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.96 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|