C24H33ClN4O4S — CID 3109650
7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methyl-8-nonylsulfanylpurine-2,6-dione (PubChem CID 3109650) has the molecular formula C24H33ClN4O4S and a molecular weight of 509.07 g/mol. Its IUPAC name is 7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methyl-8-nonylsulfanylpurine-2,6-dione.
| Compound Name | 7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methyl-8-nonylsulfanylpurine-2,6-dione |
|---|---|
| PubChem CID | 3109650 |
| Molecular Formula | C24H33ClN4O4S |
| Molecular Weight | 509.07 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 7-[3-(4-chlorophenoxy)-2-hydroxypropyl]-3-methyl-8-nonylsulfanylpurine-2,6-dione |
| SMILES | CCCCCCCCCSc1nc2c(c(=O)[nH]c(=O)n2C)n1CC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H33ClN4O4S/c1-3-4-5-6-7-8-9-14-34-24-26-21-20(22(31)27-23(32)28(21)2)29(24)15-18(30)16-33-19-12-10-17(25)11-13-19/h10-13,18,30H,3-9,14-16H2,1-2H3,(H,27,31,32) |
| InChIKey | XJDHIAKEWLDZHV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.07 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|