C23H22N4O3S — CID 1108953
3-methyl-8-phenacylsulfanyl-7-(3-phenylpropyl)purine-2,6-dione (PubChem CID 1108953) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is 3-methyl-8-phenacylsulfanyl-7-(3-phenylpropyl)purine-2,6-dione.
| Compound Name | 3-methyl-8-phenacylsulfanyl-7-(3-phenylpropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 1108953 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 3-methyl-8-phenacylsulfanyl-7-(3-phenylpropyl)purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(SCC(=O)c1ccccc1)n2CCCc1ccccc1 |
| InChI | InChI=1S/C23H22N4O3S/c1-26-20-19(21(29)25-22(26)30)27(14-8-11-16-9-4-2-5-10-16)23(24-20)31-15-18(28)17-12-6-3-7-13-17/h2-7,9-10,12-13H,8,11,14-15H2,1H3,(H,25,29,30) |
| InChIKey | NWAZMFIYEJDQEN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |