C17H20N4O2S — CID 646025
3-methyl-7-(2-phenylethyl)-8-propylsulfanylpurine-2,6-dione (PubChem CID 646025) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 3-methyl-7-(2-phenylethyl)-8-propylsulfanylpurine-2,6-dione.
| Compound Name | 3-methyl-7-(2-phenylethyl)-8-propylsulfanylpurine-2,6-dione |
|---|---|
| PubChem CID | 646025 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 3-methyl-7-(2-phenylethyl)-8-propylsulfanylpurine-2,6-dione |
| SMILES | CCCSc1nc2c(c(=O)[nH]c(=O)n2C)n1CCc1ccccc1 |
| InChI | InChI=1S/C17H20N4O2S/c1-3-11-24-17-18-14-13(15(22)19-16(23)20(14)2)21(17)10-9-12-7-5-4-6-8-12/h4-8H,3,9-11H2,1-2H3,(H,19,22,23) |
| InChIKey | KQDJFASEWAFDPZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |