C13H17ClN4O3S — CID 7008122
7-[(E)-but-2-enyl]-8-[(2S)-3-chloro-2-hydroxypropyl]sulfanyl-3-methylpurine-2,6-dione (PubChem CID 7008122) has the molecular formula C13H17ClN4O3S and a molecular weight of 344.82 g/mol. Its IUPAC name is 7-[(E)-but-2-enyl]-8-[(2S)-3-chloro-2-hydroxypropyl]sulfanyl-3-methylpurine-2,6-dione.
| Compound Name | 7-[(E)-but-2-enyl]-8-[(2S)-3-chloro-2-hydroxypropyl]sulfanyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 7008122 |
| Molecular Formula | C13H17ClN4O3S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 7-[(E)-but-2-enyl]-8-[(2S)-3-chloro-2-hydroxypropyl]sulfanyl-3-methylpurine-2,6-dione |
| SMILES | C/C=C/Cn1c(SC[C@H](O)CCl)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C13H17ClN4O3S/c1-3-4-5-18-9-10(17(2)12(21)16-11(9)20)15-13(18)22-7-8(19)6-14/h3-4,8,19H,5-7H2,1-2H3,(H,16,20,21)/b4-3+/t8-/m1/s1 |
| InChIKey | IJHFZNPXBKXENX-MPJRPATESA-N |
| XLogP | 0.69 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|