C8H11N5O3 — CID 787610
8-amino-7-(2-hydroxyethyl)-3-methylpurine-2,6-dione (PubChem CID 787610) has the molecular formula C8H11N5O3 and a molecular weight of 225.21 g/mol. Its IUPAC name is 8-amino-7-(2-hydroxyethyl)-3-methylpurine-2,6-dione.
| Compound Name | 8-amino-7-(2-hydroxyethyl)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 787610 |
| Molecular Formula | C8H11N5O3 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 8-amino-7-(2-hydroxyethyl)-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(N)n2CCO |
| InChI | InChI=1S/C8H11N5O3/c1-12-5-4(6(15)11-8(12)16)13(2-3-14)7(9)10-5/h14H,2-3H2,1H3,(H2,9,10)(H,11,15,16) |
| InChIKey | GSNRUMCAPMPAMX-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |