C10H20N6O2 — CID 143283838
8-amino-7-ethyl-3-methylpurine-2,6-dione;ethenamine;molecular hydrogen (PubChem CID 143283838) has the molecular formula C10H20N6O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 8-amino-7-ethyl-3-methylpurine-2,6-dione;ethenamine;molecular hydrogen.
| Compound Name | 8-amino-7-ethyl-3-methylpurine-2,6-dione;ethenamine;molecular hydrogen |
|---|---|
| PubChem CID | 143283838 |
| Molecular Formula | C10H20N6O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 8-amino-7-ethyl-3-methylpurine-2,6-dione;ethenamine;molecular hydrogen |
| SMILES | C=CN.CCn1c(N)nc2c1c(=O)[nH]c(=O)n2C.[H][H].[H][H] |
| InChI | InChI=1S/C8H11N5O2.C2H5N.2H2/c1-3-13-4-5(10-7(13)9)12(2)8(15)11-6(4)14;1-2-3;;/h3H2,1-2H3,(H2,9,10)(H,11,14,15);2H,1,3H2;2*1H |
| InChIKey | BJWYWEFSVMHFAV-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 124.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |