C10H15N5O2 — CID 82464399
8-amino-1,7-diethyl-3-methylpurine-2,6-dione (PubChem CID 82464399) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 8-amino-1,7-diethyl-3-methylpurine-2,6-dione.
| Compound Name | 8-amino-1,7-diethyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 82464399 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 8-amino-1,7-diethyl-3-methylpurine-2,6-dione |
| SMILES | CCn1c(=O)c2c(nc(N)n2CC)n(C)c1=O |
| InChI | InChI=1S/C10H15N5O2/c1-4-14-6-7(12-9(14)11)13(3)10(17)15(5-2)8(6)16/h4-5H2,1-3H3,(H2,11,12) |
| InChIKey | XSNQFGBQKJCMNV-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |