C10H13ClN4O2 — CID 71396865
8-(chloromethyl)-1-ethyl-3,7-dimethylpurine-2,6-dione (PubChem CID 71396865) has the molecular formula C10H13ClN4O2 and a molecular weight of 256.69 g/mol. Its IUPAC name is 8-(chloromethyl)-1-ethyl-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-(chloromethyl)-1-ethyl-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 71396865 |
| Molecular Formula | C10H13ClN4O2 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 8-(chloromethyl)-1-ethyl-3,7-dimethylpurine-2,6-dione |
| SMILES | CCn1c(=O)c2c(nc(CCl)n2C)n(C)c1=O |
| InChI | InChI=1S/C10H13ClN4O2/c1-4-15-9(16)7-8(14(3)10(15)17)12-6(5-11)13(7)2/h4-5H2,1-3H3 |
| InChIKey | XWVRKWBGVBWTJC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|