C18H22N4O2 — CID 122191021
1,3-diethyl-7-methyl-8-(2-phenylethyl)purine-2,6-dione (PubChem CID 122191021) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1,3-diethyl-7-methyl-8-(2-phenylethyl)purine-2,6-dione.
| Compound Name | 1,3-diethyl-7-methyl-8-(2-phenylethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 122191021 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1,3-diethyl-7-methyl-8-(2-phenylethyl)purine-2,6-dione |
| SMILES | CCn1c(=O)c2c(nc(CCc3ccccc3)n2C)n(CC)c1=O |
| InChI | InChI=1S/C18H22N4O2/c1-4-21-16-15(17(23)22(5-2)18(21)24)20(3)14(19-16)12-11-13-9-7-6-8-10-13/h6-10H,4-5,11-12H2,1-3H3 |
| InChIKey | BQXKDZUNKSTFJD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |