C10H14N4O2 — CID 59939546
3-ethyl-1,7,8-trimethylpurine-2,6-dione (PubChem CID 59939546) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 3-ethyl-1,7,8-trimethylpurine-2,6-dione.
| Compound Name | 3-ethyl-1,7,8-trimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 59939546 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 3-ethyl-1,7,8-trimethylpurine-2,6-dione |
| SMILES | CCn1c(=O)n(C)c(=O)c2c1nc(C)n2C |
| InChI | InChI=1S/C10H14N4O2/c1-5-14-8-7(12(3)6(2)11-8)9(15)13(4)10(14)16/h5H2,1-4H3 |
| InChIKey | CKGBUVUEAPYVHT-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |