C20H24N10O5 — CID 158557686
2-(1,7,8-trimethyl-2,6-dioxopurin-3-yl)acetamide;2-(1,7,8-trimethyl-2,6-dioxopurin-3-yl)acetonitrile (PubChem CID 158557686) has the molecular formula C20H24N10O5 and a molecular weight of 484.48 g/mol. Its IUPAC name is 2-(1,7,8-trimethyl-2,6-dioxopurin-3-yl)acetamide;2-(1,7,8-trimethyl-2,6-dioxopurin-3-yl)acetonitrile.
| Compound Name | 2-(1,7,8-trimethyl-2,6-dioxopurin-3-yl)acetamide;2-(1,7,8-trimethyl-2,6-dioxopurin-3-yl)acetonitrile |
|---|---|
| PubChem CID | 158557686 |
| Molecular Formula | C20H24N10O5 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 2-(1,7,8-trimethyl-2,6-dioxopurin-3-yl)acetamide;2-(1,7,8-trimethyl-2,6-dioxopurin-3-yl)acetonitrile |
| SMILES | Cc1nc2c(c(=O)n(C)c(=O)n2CC#N)n1C.Cc1nc2c(c(=O)n(C)c(=O)n2CC(N)=O)n1C |
| InChI | InChI=1S/C10H13N5O3.C10H11N5O2/c1-5-12-8-7(13(5)2)9(17)14(3)10(18)15(8)4-6(11)16;1-6-12-8-7(13(6)2)9(16)14(3)10(17)15(8)5-4-11/h4H2,1-3H3,(H2,11,16);5H2,1-3H3 |
| InChIKey | HQMKYYSRJGZIDT-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 190.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |