C14H23N5O3 — CID 82465968
7-(4-aminobutyl)-3-(2-methoxyethyl)-1,8-dimethylpurine-2,6-dione (PubChem CID 82465968) has the molecular formula C14H23N5O3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 7-(4-aminobutyl)-3-(2-methoxyethyl)-1,8-dimethylpurine-2,6-dione.
| Compound Name | 7-(4-aminobutyl)-3-(2-methoxyethyl)-1,8-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 82465968 |
| Molecular Formula | C14H23N5O3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 7-(4-aminobutyl)-3-(2-methoxyethyl)-1,8-dimethylpurine-2,6-dione |
| SMILES | COCCn1c(=O)n(C)c(=O)c2c1nc(C)n2CCCCN |
| InChI | InChI=1S/C14H23N5O3/c1-10-16-12-11(18(10)7-5-4-6-15)13(20)17(2)14(21)19(12)8-9-22-3/h4-9,15H2,1-3H3 |
| InChIKey | JYLPFERNVSINLY-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|