C12H17ClN4O3 — CID 82465077
8-(chloromethyl)-7-ethyl-3-(2-methoxyethyl)-1-methylpurine-2,6-dione (PubChem CID 82465077) has the molecular formula C12H17ClN4O3 and a molecular weight of 300.75 g/mol. Its IUPAC name is 8-(chloromethyl)-7-ethyl-3-(2-methoxyethyl)-1-methylpurine-2,6-dione.
| Compound Name | 8-(chloromethyl)-7-ethyl-3-(2-methoxyethyl)-1-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 82465077 |
| Molecular Formula | C12H17ClN4O3 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 8-(chloromethyl)-7-ethyl-3-(2-methoxyethyl)-1-methylpurine-2,6-dione |
| SMILES | CCn1c(CCl)nc2c1c(=O)n(C)c(=O)n2CCOC |
| InChI | InChI=1S/C12H17ClN4O3/c1-4-16-8(7-13)14-10-9(16)11(18)15(2)12(19)17(10)5-6-20-3/h4-7H2,1-3H3 |
| InChIKey | GBLMPKLJUQZHMU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|