C11H15ClN4O3 — CID 82465458
8-(chloromethyl)-7-ethyl-3-(2-methoxyethyl)purine-2,6-dione (PubChem CID 82465458) has the molecular formula C11H15ClN4O3 and a molecular weight of 286.72 g/mol. Its IUPAC name is 8-(chloromethyl)-7-ethyl-3-(2-methoxyethyl)purine-2,6-dione.
| Compound Name | 8-(chloromethyl)-7-ethyl-3-(2-methoxyethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 82465458 |
| Molecular Formula | C11H15ClN4O3 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 8-(chloromethyl)-7-ethyl-3-(2-methoxyethyl)purine-2,6-dione |
| SMILES | CCn1c(CCl)nc2c1c(=O)[nH]c(=O)n2CCOC |
| InChI | InChI=1S/C11H15ClN4O3/c1-3-15-7(6-12)13-9-8(15)10(17)14-11(18)16(9)4-5-19-2/h3-6H2,1-2H3,(H,14,17,18) |
| InChIKey | KNIPZSQMOWCELF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|