C20H24N4O5 — CID 7503927
(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-methoxybenzoate (PubChem CID 7503927) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-methoxybenzoate.
| Compound Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-methoxybenzoate |
|---|---|
| PubChem CID | 7503927 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-methoxybenzoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)c1cccc(OC)c1)n2CC |
| InChI | InChI=1S/C20H24N4O5/c1-4-6-10-24-17-16(18(25)22-20(24)27)23(5-2)15(21-17)12-29-19(26)13-8-7-9-14(11-13)28-3/h7-9,11H,4-6,10,12H2,1-3H3,(H,22,25,27) |
| InChIKey | FPLZEXLWMMNSNQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |