C23H27N5O5 — CID 46609827
(3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 46609827) has the molecular formula C23H27N5O5 and a molecular weight of 453.50 g/mol. Its IUPAC name is (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 46609827 |
| Molecular Formula | C23H27N5O5 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | (3-butyl-7-ethyl-2,6-dioxopurin-8-yl)methyl 3-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | CCCCn1c(=O)[nH]c(=O)c2c1nc(COC(=O)c1cccc(N3CCCC3=O)c1)n2CC |
| InChI | InChI=1S/C23H27N5O5/c1-3-5-11-28-20-19(21(30)25-23(28)32)26(4-2)17(24-20)14-33-22(31)15-8-6-9-16(13-15)27-12-7-10-18(27)29/h6,8-9,13H,3-5,7,10-12,14H2,1-2H3,(H,25,30,32) |
| InChIKey | CEIBXLPTNKROBM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |